C10H8Br2N2 — CID 125426485
(6,8-dibromoisoquinolin-1-yl)methanamine (PubChem CID 125426485) has the molecular formula C10H8Br2N2 and a molecular weight of 316.00 g/mol. Its IUPAC name is (6,8-dibromoisoquinolin-1-yl)methanamine.
| Compound Name | (6,8-dibromoisoquinolin-1-yl)methanamine |
|---|---|
| PubChem CID | 125426485 |
| Molecular Formula | C10H8Br2N2 |
| Molecular Weight | 316.00 g/mol |
| Exact Mass | 313.91 |
| IUPAC Name | (6,8-dibromoisoquinolin-1-yl)methanamine |
| SMILES | NCc1nccc2cc(Br)cc(Br)c12 |
| InChI | InChI=1S/C10H8Br2N2/c11-7-3-6-1-2-14-9(5-13)10(6)8(12)4-7/h1-4H,5,13H2 |
| InChIKey | JYSIVJCMEPQMJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.00 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |