C10H4Br4 — CID 135202272
1,2,6,8-tetrabromonaphthalene (PubChem CID 135202272) has the molecular formula C10H4Br4 and a molecular weight of 443.76 g/mol. Its IUPAC name is 1,2,6,8-tetrabromonaphthalene.
| Compound Name | 1,2,6,8-tetrabromonaphthalene |
|---|---|
| PubChem CID | 135202272 |
| Molecular Formula | C10H4Br4 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 439.70 |
| IUPAC Name | 1,2,6,8-tetrabromonaphthalene |
| SMILES | Brc1cc(Br)c2c(Br)c(Br)ccc2c1 |
| InChI | InChI=1S/C10H4Br4/c11-6-3-5-1-2-7(12)10(14)9(5)8(13)4-6/h1-4H |
| InChIKey | KCQVFNLHVQBSOA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |