C14H7BrN2 — CID 156630807
13-bromo-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene (PubChem CID 156630807) has the molecular formula C14H7BrN2 and a molecular weight of 283.13 g/mol. Its IUPAC name is 13-bromo-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene.
| Compound Name | 13-bromo-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
|---|---|
| PubChem CID | 156630807 |
| Molecular Formula | C14H7BrN2 |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 13-bromo-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
| SMILES | Brc1cc2ccc3ncnc4ccc(c1)c2c34 |
| InChI | InChI=1S/C14H7BrN2/c15-10-5-8-1-3-11-14-12(17-7-16-11)4-2-9(6-10)13(8)14/h1-7H |
| InChIKey | MXLOVPLXHCPFMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|