C14H6Br2N2 — CID 155655747
6,13-dibromo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene (PubChem CID 155655747) has the molecular formula C14H6Br2N2 and a molecular weight of 362.02 g/mol. Its IUPAC name is 6,13-dibromo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene.
| Compound Name | 6,13-dibromo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
|---|---|
| PubChem CID | 155655747 |
| Molecular Formula | C14H6Br2N2 |
| Molecular Weight | 362.02 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 6,13-dibromo-2,9-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
| SMILES | Brc1cc2cnc3cc(Br)cc4cnc(c1)c2c43 |
| InChI | InChI=1S/C14H6Br2N2/c15-9-1-7-5-17-12-4-10(16)2-8-6-18-11(3-9)13(7)14(8)12/h1-6H |
| InChIKey | GYANRSGYVLULKI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.02 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|