About 3,8-dibromonaphthalen-1-ol
3,8-dibromonaphthalen-1-ol (PubChem CID 142668001) has the molecular formula C10H6Br2O
and a molecular weight of 301.97 g/mol. Its IUPAC name is 3,8-dibromonaphthalen-1-ol.
Molecular Properties
| Compound Name | 3,8-dibromonaphthalen-1-ol |
| PubChem CID | 142668001 |
| Molecular Formula | C10H6Br2O |
| Molecular Weight | 301.97 g/mol |
| Exact Mass | 299.88 |
| IUPAC Name | 3,8-dibromonaphthalen-1-ol |
| SMILES | Oc1cc(Br)cc2cccc(Br)c12 |
| InChI | InChI=1S/C10H6Br2O/c11-7-4-6-2-1-3-8(12)10(6)9(13)5-7/h1-5,13H |
| InChIKey | KOYDYHLWGPBWHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,8-dibromonaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dibromonaphthalen-1-ol?
The IUPAC name of 3,8-dibromonaphthalen-1-ol (CID 142668001) is 3,8-dibromonaphthalen-1-ol.
What is the SMILES notation for 3,8-dibromonaphthalen-1-ol?
The canonical SMILES for 3,8-dibromonaphthalen-1-ol is Oc1cc(Br)cc2cccc(Br)c12.
What is the InChIKey of 3,8-dibromonaphthalen-1-ol?
The InChIKey is KOYDYHLWGPBWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2O/c11-7-4-6-2-1-3-8(12)10(6)9(13)5-7/h1-5,13H.
What are the key properties of 3,8-dibromonaphthalen-1-ol?
3,8-dibromonaphthalen-1-ol has a molecular weight of 301.97 g/mol, XLogP of 4.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dibromonaphthalen-1-ol is sourced from PubChem (CID 142668001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).