C12H5Br5 — CID 90478885
1,2,4-tribromo-3-(3,5-dibromophenyl)benzene (PubChem CID 90478885) has the molecular formula C12H5Br5 and a molecular weight of 548.69 g/mol. Its IUPAC name is 1,2,4-tribromo-3-(3,5-dibromophenyl)benzene.
| Compound Name | 1,2,4-tribromo-3-(3,5-dibromophenyl)benzene |
|---|---|
| PubChem CID | 90478885 |
| Molecular Formula | C12H5Br5 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 543.63 |
| IUPAC Name | 1,2,4-tribromo-3-(3,5-dibromophenyl)benzene |
| SMILES | Brc1cc(Br)cc(-c2c(Br)ccc(Br)c2Br)c1 |
| InChI | InChI=1S/C12H5Br5/c13-7-3-6(4-8(14)5-7)11-9(15)1-2-10(16)12(11)17/h1-5H |
| InChIKey | UMFKUWYQACGSMQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|