C13H10Br2O — CID 56604636
[4-(3,5-dibromophenyl)phenyl]methanol (PubChem CID 56604636) has the molecular formula C13H10Br2O and a molecular weight of 342.03 g/mol. Its IUPAC name is [4-(3,5-dibromophenyl)phenyl]methanol.
| Compound Name | [4-(3,5-dibromophenyl)phenyl]methanol |
|---|---|
| PubChem CID | 56604636 |
| Molecular Formula | C13H10Br2O |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | [4-(3,5-dibromophenyl)phenyl]methanol |
| SMILES | OCc1ccc(-c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C13H10Br2O/c14-12-5-11(6-13(15)7-12)10-3-1-9(8-16)2-4-10/h1-7,16H,8H2 |
| InChIKey | RTUZYPSWVMJMDS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |