C9H12Br2O — CID 144557111
(3,5-dibromophenyl)methanol;ethane (PubChem CID 144557111) has the molecular formula C9H12Br2O and a molecular weight of 296.00 g/mol. Its IUPAC name is (3,5-dibromophenyl)methanol;ethane.
| Compound Name | (3,5-dibromophenyl)methanol;ethane |
|---|---|
| PubChem CID | 144557111 |
| Molecular Formula | C9H12Br2O |
| Molecular Weight | 296.00 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | (3,5-dibromophenyl)methanol;ethane |
| SMILES | CC.OCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C7H6Br2O.C2H6/c8-6-1-5(4-10)2-7(9)3-6;1-2/h1-3,10H,4H2;1-2H3 |
| InChIKey | VDTDOMRXXQYIPB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.00 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |