About (3-bromobenzene-5-id-1-yl)methanol;cobalt
(3-bromobenzene-5-id-1-yl)methanol;cobalt (PubChem CID 177134279) has the molecular formula C7H6BrCoO-
and a molecular weight of 244.96 g/mol. Its IUPAC name is (3-bromobenzene-5-id-1-yl)methanol;cobalt.
Molecular Properties
| Compound Name | (3-bromobenzene-5-id-1-yl)methanol;cobalt |
| PubChem CID | 177134279 |
| Molecular Formula | C7H6BrCoO- |
| Molecular Weight | 244.96 g/mol |
| Exact Mass | 243.89 |
| IUPAC Name | (3-bromobenzene-5-id-1-yl)methanol;cobalt |
| SMILES | OCc1c[c-]cc(Br)c1.[Co] |
| InChI | InChI=1S/C7H6BrO.Co/c8-7-3-1-2-6(4-7)5-9;/h2-4,9H,5H2;/q-1; |
| InChIKey | BUKQGBQMHBQHIU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.96 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (3-bromobenzene-5-id-1-yl)methanol;cobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromobenzene-5-id-1-yl)methanol;cobalt?
The IUPAC name of (3-bromobenzene-5-id-1-yl)methanol;cobalt (CID 177134279) is (3-bromobenzene-5-id-1-yl)methanol;cobalt.
What is the SMILES notation for (3-bromobenzene-5-id-1-yl)methanol;cobalt?
The canonical SMILES for (3-bromobenzene-5-id-1-yl)methanol;cobalt is OCc1c[c-]cc(Br)c1.[Co].
What is the InChIKey of (3-bromobenzene-5-id-1-yl)methanol;cobalt?
The InChIKey is BUKQGBQMHBQHIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrO.Co/c8-7-3-1-2-6(4-7)5-9;/h2-4,9H,5H2;/q-1;.
What are the key properties of (3-bromobenzene-5-id-1-yl)methanol;cobalt?
(3-bromobenzene-5-id-1-yl)methanol;cobalt has a molecular weight of 244.96 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromobenzene-5-id-1-yl)methanol;cobalt is sourced from PubChem (CID 177134279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).