About [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane
[3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane (PubChem CID 142281106) has the molecular formula C20H28O4
and a molecular weight of 332.44 g/mol. Its IUPAC name is [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane.
Molecular Properties
| Compound Name | [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane |
| PubChem CID | 142281106 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane |
| SMILES | CC.CC(c1cc(CO)cc(CO)c1)c1cc(CO)cc(CO)c1 |
| InChI | InChI=1S/C18H22O4.C2H6/c1-12(17-4-13(8-19)2-14(5-17)9-20)18-6-15(10-21)3-16(7-18)11-22;1-2/h2-7,12,19-22H,8-11H2,1H3;1-2H3 |
| InChIKey | XWJZRVOYYKVCQH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane?
The IUPAC name of [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane (CID 142281106) is [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane.
What is the SMILES notation for [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane?
The canonical SMILES for [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane is CC.CC(c1cc(CO)cc(CO)c1)c1cc(CO)cc(CO)c1.
What is the InChIKey of [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane?
The InChIKey is XWJZRVOYYKVCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4.C2H6/c1-12(17-4-13(8-19)2-14(5-17)9-20)18-6-15(10-21)3-16(7-18)11-22;1-2/h2-7,12,19-22H,8-11H2,1H3;1-2H3.
What are the key properties of [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane?
[3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane has a molecular weight of 332.44 g/mol, XLogP of 2.83, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[1-[3,5-bis(hydroxymethyl)phenyl]ethyl]-5-(hydroxymethyl)phenyl]methanol;ethane is sourced from PubChem (CID 142281106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).