C11H10Cl2N2 — CID 82575496
2-(6,8-dichloroisoquinolin-1-yl)ethanamine (PubChem CID 82575496) has the molecular formula C11H10Cl2N2 and a molecular weight of 241.12 g/mol. Its IUPAC name is 2-(6,8-dichloroisoquinolin-1-yl)ethanamine.
| Compound Name | 2-(6,8-dichloroisoquinolin-1-yl)ethanamine |
|---|---|
| PubChem CID | 82575496 |
| Molecular Formula | C11H10Cl2N2 |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-(6,8-dichloroisoquinolin-1-yl)ethanamine |
| SMILES | NCCc1nccc2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C11H10Cl2N2/c12-8-5-7-2-4-15-10(1-3-14)11(7)9(13)6-8/h2,4-6H,1,3,14H2 |
| InChIKey | JJXCOBNDTDYKOO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |