C12H12Cl2N2 — CID 82245360
2-(6,8-dichloro-3-methylquinolin-2-yl)ethanamine (PubChem CID 82245360) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is 2-(6,8-dichloro-3-methylquinolin-2-yl)ethanamine.
| Compound Name | 2-(6,8-dichloro-3-methylquinolin-2-yl)ethanamine |
|---|---|
| PubChem CID | 82245360 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(6,8-dichloro-3-methylquinolin-2-yl)ethanamine |
| SMILES | Cc1cc2cc(Cl)cc(Cl)c2nc1CCN |
| InChI | InChI=1S/C12H12Cl2N2/c1-7-4-8-5-9(13)6-10(14)12(8)16-11(7)2-3-15/h4-6H,2-3,15H2,1H3 |
| InChIKey | PSKYUBYGNSABTM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |