About [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride
[2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride (PubChem CID 167525982) has the molecular formula C13H13Cl3N2
and a molecular weight of 303.62 g/mol. Its IUPAC name is [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride |
| PubChem CID | 167525982 |
| Molecular Formula | C13H13Cl3N2 |
| Molecular Weight | 303.62 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1cccnc1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2.ClH/c14-11-4-3-9(12(15)7-11)6-13-10(8-16)2-1-5-17-13;/h1-5,7H,6,8,16H2;1H |
| InChIKey | WZXNDRKUWSEVIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride?
The IUPAC name of [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride (CID 167525982) is [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride.
What is the SMILES notation for [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride?
The canonical SMILES for [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride is Cl.NCc1cccnc1Cc1ccc(Cl)cc1Cl.
What is the InChIKey of [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride?
The InChIKey is WZXNDRKUWSEVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2.ClH/c14-11-4-3-9(12(15)7-11)6-13-10(8-16)2-1-5-17-13;/h1-5,7H,6,8,16H2;1H.
What are the key properties of [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride?
[2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride has a molecular weight of 303.62 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dichlorophenyl)methyl]-3-pyridinyl]methanamine;hydrochloride is sourced from PubChem (CID 167525982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).