C12H8Cl3N — CID 121010447
3,5-dichloro-2-[(2-chlorophenyl)methyl]pyridine (PubChem CID 121010447) has the molecular formula C12H8Cl3N and a molecular weight of 272.56 g/mol. Its IUPAC name is 3,5-dichloro-2-[(2-chlorophenyl)methyl]pyridine.
| Compound Name | 3,5-dichloro-2-[(2-chlorophenyl)methyl]pyridine |
|---|---|
| PubChem CID | 121010447 |
| Molecular Formula | C12H8Cl3N |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 3,5-dichloro-2-[(2-chlorophenyl)methyl]pyridine |
| SMILES | Clc1cnc(Cc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl3N/c13-9-6-11(15)12(16-7-9)5-8-3-1-2-4-10(8)14/h1-4,6-7H,5H2 |
| InChIKey | PUJMKENWCQHWKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |