C8H14N4O2 — CID 106235178
2-[2-(1H-imidazol-5-ylmethylamino)ethoxy]acetamide (PubChem CID 106235178) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-5-ylmethylamino)ethoxy]acetamide.
| Compound Name | 2-[2-(1H-imidazol-5-ylmethylamino)ethoxy]acetamide |
|---|---|
| PubChem CID | 106235178 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-[2-(1H-imidazol-5-ylmethylamino)ethoxy]acetamide |
| SMILES | NC(=O)COCCNCc1cnc[nH]1 |
| InChI | InChI=1S/C8H14N4O2/c9-8(13)5-14-2-1-10-3-7-4-11-6-12-7/h4,6,10H,1-3,5H2,(H2,9,13)(H,11,12) |
| InChIKey | XQEJQCCIYXOMLP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|