C11H20N4O — CID 115615526
N-[2-(1H-imidazol-5-ylmethylamino)ethyl]-2,2-dimethylpropanamide (PubChem CID 115615526) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-ylmethylamino)ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-(1H-imidazol-5-ylmethylamino)ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 115615526 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-[2-(1H-imidazol-5-ylmethylamino)ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCNCc1cnc[nH]1 |
| InChI | InChI=1S/C11H20N4O/c1-11(2,3)10(16)14-5-4-12-6-9-7-13-8-15-9/h7-8,12H,4-6H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | FQZCWMZSADANOH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|