About 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol
2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 113393731) has the molecular formula C12H16Br2N2O
and a molecular weight of 364.08 g/mol. Its IUPAC name is 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol |
| PubChem CID | 113393731 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | OC1CCCC1CNCc1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O/c13-9-4-10(14)11(16-6-9)7-15-5-8-2-1-3-12(8)17/h4,6,8,12,15,17H,1-3,5,7H2 |
| InChIKey | SBJAKWQMIWFCSM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol?
The IUPAC name of 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol (CID 113393731) is 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol?
The canonical SMILES for 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol is OC1CCCC1CNCc1ncc(Br)cc1Br.
What is the InChIKey of 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol?
The InChIKey is SBJAKWQMIWFCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Br2N2O/c13-9-4-10(14)11(16-6-9)7-15-5-8-2-1-3-12(8)17/h4,6,8,12,15,17H,1-3,5,7H2.
What are the key properties of 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol?
2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol has a molecular weight of 364.08 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3,5-dibromo-2-pyridinyl)methylamino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 113393731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).