C13H13BrN4S — CID 79166300
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 79166300) has the molecular formula C13H13BrN4S and a molecular weight of 337.25 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 79166300 |
| Molecular Formula | C13H13BrN4S |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Brc1cn2c(CNCCc3ccsc3)cnc2cn1 |
| InChI | InChI=1S/C13H13BrN4S/c14-12-8-18-11(6-17-13(18)7-16-12)5-15-3-1-10-2-4-19-9-10/h2,4,6-9,15H,1,3,5H2 |
| InChIKey | URNWABZCKGGLDB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|