About N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine (PubChem CID 79177061) has the molecular formula C14H19BrN4O
and a molecular weight of 339.24 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine.
Molecular Properties
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine |
| PubChem CID | 79177061 |
| Molecular Formula | C14H19BrN4O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine |
| SMILES | Brc1cn2c(CNCCCOCC3CC3)cnc2cn1 |
| InChI | InChI=1S/C14H19BrN4O/c15-13-9-19-12(7-18-14(19)8-17-13)6-16-4-1-5-20-10-11-2-3-11/h7-9,11,16H,1-6,10H2 |
| InChIKey | PSOXIYDKMPNLDA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine?
The IUPAC name of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine (CID 79177061) is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine.
What is the SMILES notation for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine?
The canonical SMILES for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine is Brc1cn2c(CNCCCOCC3CC3)cnc2cn1.
What is the InChIKey of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine?
The InChIKey is PSOXIYDKMPNLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN4O/c15-13-9-19-12(7-18-14(19)8-17-13)6-16-4-1-5-20-10-11-2-3-11/h7-9,11,16H,1-6,10H2.
What are the key properties of N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine?
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine has a molecular weight of 339.24 g/mol, XLogP of 2.40, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-3-(cyclopropylmethoxy)propan-1-amine is sourced from PubChem (CID 79177061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).