C13H17Cl2NO3 — CID 81462864
tert-butyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]acetate (PubChem CID 81462864) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]acetate.
| Compound Name | tert-butyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]acetate |
|---|---|
| PubChem CID | 81462864 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | tert-butyl 2-[(3,5-dichloro-2-hydroxyphenyl)methylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H17Cl2NO3/c1-13(2,3)19-11(17)7-16-6-8-4-9(14)5-10(15)12(8)18/h4-5,16,18H,6-7H2,1-3H3 |
| InChIKey | GHEBOTMCOURBCH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|