C16H24Cl2N2O3 — CID 141015684
tert-butyl 2-[2-[(3-aminopropylamino)methyl]-4,6-dichlorophenoxy]acetate (PubChem CID 141015684) has the molecular formula C16H24Cl2N2O3 and a molecular weight of 363.29 g/mol. Its IUPAC name is tert-butyl 2-[2-[(3-aminopropylamino)methyl]-4,6-dichlorophenoxy]acetate.
| Compound Name | tert-butyl 2-[2-[(3-aminopropylamino)methyl]-4,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 141015684 |
| Molecular Formula | C16H24Cl2N2O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | tert-butyl 2-[2-[(3-aminopropylamino)methyl]-4,6-dichlorophenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1c(Cl)cc(Cl)cc1CNCCCN |
| InChI | InChI=1S/C16H24Cl2N2O3/c1-16(2,3)23-14(21)10-22-15-11(9-20-6-4-5-19)7-12(17)8-13(15)18/h7-8,20H,4-6,9-10,19H2,1-3H3 |
| InChIKey | LRLVKMIUSWHQOD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|