C15H14N4S — CID 106936467
N-[(1-ethenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)aniline (PubChem CID 106936467) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-[(1-ethenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[(1-ethenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 106936467 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[(1-ethenylpyrazol-4-yl)methyl]-4-(1,3-thiazol-2-yl)aniline |
| SMILES | C=Cn1cc(CNc2ccc(-c3nccs3)cc2)cn1 |
| InChI | InChI=1S/C15H14N4S/c1-2-19-11-12(10-18-19)9-17-14-5-3-13(4-6-14)15-16-7-8-20-15/h2-8,10-11,17H,1,9H2 |
| InChIKey | QMNSNRQCBFBERQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |