C13H21NO3 — CID 168597577
3-(3-butoxyanilino)propane-1,2-diol (PubChem CID 168597577) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(3-butoxyanilino)propane-1,2-diol.
| Compound Name | 3-(3-butoxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168597577 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(3-butoxyanilino)propane-1,2-diol |
| SMILES | CCCCOc1cccc(NCC(O)CO)c1 |
| InChI | InChI=1S/C13H21NO3/c1-2-3-7-17-13-6-4-5-11(8-13)14-9-12(16)10-15/h4-6,8,12,14-16H,2-3,7,9-10H2,1H3 |
| InChIKey | SNZHNBQWFBQBJX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|