C18H31NO3 — CID 168593717
3-(4-nonoxyanilino)propane-1,2-diol (PubChem CID 168593717) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 3-(4-nonoxyanilino)propane-1,2-diol.
| Compound Name | 3-(4-nonoxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168593717 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 3-(4-nonoxyanilino)propane-1,2-diol |
| SMILES | CCCCCCCCCOc1ccc(NCC(O)CO)cc1 |
| InChI | InChI=1S/C18H31NO3/c1-2-3-4-5-6-7-8-13-22-18-11-9-16(10-12-18)19-14-17(21)15-20/h9-12,17,19-21H,2-8,13-15H2,1H3 |
| InChIKey | OYLNEJVXGKJKKP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|