C14H19NO6 — CID 168594143
2-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]butanedioic acid (PubChem CID 168594143) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]butanedioic acid.
| Compound Name | 2-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]butanedioic acid |
|---|---|
| PubChem CID | 168594143 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[[4-(2,3-dihydroxypropylamino)phenyl]methyl]butanedioic acid |
| SMILES | O=C(O)CC(Cc1ccc(NCC(O)CO)cc1)C(=O)O |
| InChI | InChI=1S/C14H19NO6/c16-8-12(17)7-15-11-3-1-9(2-4-11)5-10(14(20)21)6-13(18)19/h1-4,10,12,15-17H,5-8H2,(H,18,19)(H,20,21) |
| InChIKey | XLLILYJTJHGJPU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |