C15H18N2O4 — CID 168597625
N-[4-(2,3-dihydroxypropylamino)phenyl]-5-methylfuran-2-carboxamide (PubChem CID 168597625) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[4-(2,3-dihydroxypropylamino)phenyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[4-(2,3-dihydroxypropylamino)phenyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 168597625 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[4-(2,3-dihydroxypropylamino)phenyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(NCC(O)CO)cc2)o1 |
| InChI | InChI=1S/C15H18N2O4/c1-10-2-7-14(21-10)15(20)17-12-5-3-11(4-6-12)16-8-13(19)9-18/h2-7,13,16,18-19H,8-9H2,1H3,(H,17,20) |
| InChIKey | DODKJPBCWNTJRN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |