C16H19NO3 — CID 13273040
(2S)-3-(4-phenylmethoxyanilino)propane-1,2-diol (PubChem CID 13273040) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S)-3-(4-phenylmethoxyanilino)propane-1,2-diol.
| Compound Name | (2S)-3-(4-phenylmethoxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 13273040 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (2S)-3-(4-phenylmethoxyanilino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H19NO3/c18-11-15(19)10-17-14-6-8-16(9-7-14)20-12-13-4-2-1-3-5-13/h1-9,15,17-19H,10-12H2/t15-/m0/s1 |
| InChIKey | PTVDPONOUBBLRI-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|