C19H18ClNO3 — CID 168596365
3-(3-chloro-4-naphthalen-2-yloxyanilino)propane-1,2-diol (PubChem CID 168596365) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 3-(3-chloro-4-naphthalen-2-yloxyanilino)propane-1,2-diol.
| Compound Name | 3-(3-chloro-4-naphthalen-2-yloxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168596365 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-(3-chloro-4-naphthalen-2-yloxyanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ccc(Oc2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C19H18ClNO3/c20-18-10-15(21-11-16(23)12-22)6-8-19(18)24-17-7-5-13-3-1-2-4-14(13)9-17/h1-10,16,21-23H,11-12H2 |
| InChIKey | MOIKOGGYSVJLOT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |