C17H19Cl2NO2 — CID 168639426
1-chloro-3-[3-chloro-4-(2,4-dimethylphenoxy)anilino]propan-2-ol (PubChem CID 168639426) has the molecular formula C17H19Cl2NO2 and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-chloro-3-[3-chloro-4-(2,4-dimethylphenoxy)anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[3-chloro-4-(2,4-dimethylphenoxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 168639426 |
| Molecular Formula | C17H19Cl2NO2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-chloro-3-[3-chloro-4-(2,4-dimethylphenoxy)anilino]propan-2-ol |
| SMILES | Cc1ccc(Oc2ccc(NCC(O)CCl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H19Cl2NO2/c1-11-3-5-16(12(2)7-11)22-17-6-4-13(8-15(17)19)20-10-14(21)9-18/h3-8,14,20-21H,9-10H2,1-2H3 |
| InChIKey | SLLDXBCJHUXADN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|