C27H20N4O — CID 71379490
4-[4-[bis(4-aminophenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 71379490) has the molecular formula C27H20N4O and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[4-[bis(4-aminophenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[bis(4-aminophenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71379490 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-[4-[bis(4-aminophenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C(c3ccc(N)cc3)c3ccc(N)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C27H20N4O/c28-16-21-7-14-26(15-22(21)17-29)32-25-12-5-20(6-13-25)27(18-1-8-23(30)9-2-18)19-3-10-24(31)11-4-19/h1-15,27H,30-31H2 |
| InChIKey | UXZLEOXRAAFRBW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|