C18H15N5O — CID 169338246
3-[2-(dicyanomethylidene)hydrazinyl]-N-(3,4-dimethylphenyl)benzamide (PubChem CID 169338246) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-[2-(dicyanomethylidene)hydrazinyl]-N-(3,4-dimethylphenyl)benzamide.
| Compound Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N-(3,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 169338246 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N-(3,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(NN=C(C#N)C#N)c2)cc1C |
| InChI | InChI=1S/C18H15N5O/c1-12-6-7-15(8-13(12)2)21-18(24)14-4-3-5-16(9-14)22-23-17(10-19)11-20/h3-9,22H,1-2H3,(H,21,24) |
| InChIKey | VNCXEISMYAMTQC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|