C14H15N5O — CID 169338365
3-[2-(dicyanomethylidene)hydrazinyl]-N-(2-methylpropyl)benzamide (PubChem CID 169338365) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 3-[2-(dicyanomethylidene)hydrazinyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 169338365 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 3-[2-(dicyanomethylidene)hydrazinyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cccc(NN=C(C#N)C#N)c1 |
| InChI | InChI=1S/C14H15N5O/c1-10(2)9-17-14(20)11-4-3-5-12(6-11)18-19-13(7-15)8-16/h3-6,10,18H,9H2,1-2H3,(H,17,20) |
| InChIKey | GEXYOVYONLMNIY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|