C16H12ClN7 — CID 172979788
(1Z)-2-amino-N-[3-(6-chloroimidazo[1,2-a]pyridin-2-yl)anilino]-2-iminoethanimidoyl cyanide (PubChem CID 172979788) has the molecular formula C16H12ClN7 and a molecular weight of 337.77 g/mol. Its IUPAC name is (1Z)-2-amino-N-[3-(6-chloroimidazo[1,2-a]pyridin-2-yl)anilino]-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-[3-(6-chloroimidazo[1,2-a]pyridin-2-yl)anilino]-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979788 |
| Molecular Formula | C16H12ClN7 |
| Molecular Weight | 337.77 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (1Z)-2-amino-N-[3-(6-chloroimidazo[1,2-a]pyridin-2-yl)anilino]-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc(-c2cn3cc(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C16H12ClN7/c17-11-4-5-15-21-14(9-24(15)8-11)10-2-1-3-12(6-10)22-23-13(7-18)16(19)20/h1-6,8-9,22H,(H3,19,20)/b23-13+ |
| InChIKey | SHKSVDIZTAXCHG-YDZHTSKRSA-N |
| XLogP | 2.88 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|