C15H16N2O3S2 — CID 2991974
2-methyl-5-[(3-methylsulfanylphenyl)sulfamoyl]benzamide (PubChem CID 2991974) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylsulfanylphenyl)sulfamoyl]benzamide.
| Compound Name | 2-methyl-5-[(3-methylsulfanylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2991974 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-methyl-5-[(3-methylsulfanylphenyl)sulfamoyl]benzamide |
| SMILES | CSc1cccc(NS(=O)(=O)c2ccc(C)c(C(N)=O)c2)c1 |
| InChI | InChI=1S/C15H16N2O3S2/c1-10-6-7-13(9-14(10)15(16)18)22(19,20)17-11-4-3-5-12(8-11)21-2/h3-9,17H,1-2H3,(H2,16,18) |
| InChIKey | MCJXCQDLWTZOLS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |