C16H14N2O6S2 — CID 168527507
3-(furan-2-yl)-4-hydroxy-N-(3-sulfamoylphenyl)benzenesulfonamide (PubChem CID 168527507) has the molecular formula C16H14N2O6S2 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-hydroxy-N-(3-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 3-(furan-2-yl)-4-hydroxy-N-(3-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168527507 |
| Molecular Formula | C16H14N2O6S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 3-(furan-2-yl)-4-hydroxy-N-(3-sulfamoylphenyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NS(=O)(=O)c2ccc(O)c(-c3ccco3)c2)c1 |
| InChI | InChI=1S/C16H14N2O6S2/c17-25(20,21)12-4-1-3-11(9-12)18-26(22,23)13-6-7-15(19)14(10-13)16-5-2-8-24-16/h1-10,18-19H,(H2,17,20,21) |
| InChIKey | UJXKBPPNRVRIHL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |