C9H15N5O2S — CID 116512166
1-amino-2-ethyl-3-(3-sulfamoylphenyl)guanidine (PubChem CID 116512166) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 1-amino-2-ethyl-3-(3-sulfamoylphenyl)guanidine.
| Compound Name | 1-amino-2-ethyl-3-(3-sulfamoylphenyl)guanidine |
|---|---|
| PubChem CID | 116512166 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-amino-2-ethyl-3-(3-sulfamoylphenyl)guanidine |
| SMILES | CC/N=C(\NN)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H15N5O2S/c1-2-12-9(14-10)13-7-4-3-5-8(6-7)17(11,15)16/h3-6H,2,10H2,1H3,(H2,11,15,16)(H2,12,13,14) |
| InChIKey | DFVTZBYERQRHDJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|