C17H18N2O4S — CID 56793355
1-pyridin-4-ylethyl 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 56793355) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-pyridin-4-ylethyl 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | 1-pyridin-4-ylethyl 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 56793355 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-pyridin-4-ylethyl 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)NC2CC2)c1)c1ccncc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12(13-7-9-18-10-8-13)23-17(20)14-3-2-4-16(11-14)24(21,22)19-15-5-6-15/h2-4,7-12,15,19H,5-6H2,1H3 |
| InChIKey | CUKSOPHWPPJLRJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |