C21H23N3O6S — CID 46625737
[1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 46625737) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46625737 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [1-(benzylcarbamoylamino)-1-oxopropan-2-yl] 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)NC2CC2)c1)C(=O)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-14(19(25)23-21(27)22-13-15-6-3-2-4-7-15)30-20(26)16-8-5-9-18(12-16)31(28,29)24-17-10-11-17/h2-9,12,14,17,24H,10-11,13H2,1H3,(H2,22,23,25,27) |
| InChIKey | SXNWWECZANWRJK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |