C19H25N3O6S — CID 8987385
[(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate (PubChem CID 8987385) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8987385 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)O[C@H](C)C(=O)NC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C19H25N3O6S/c1-3-11-20-29(26,27)16-10-6-7-14(12-16)18(24)28-13(2)17(23)22-19(25)21-15-8-4-5-9-15/h3,6-7,10,12-13,15,20H,1,4-5,8-9,11H2,2H3,(H2,21,22,23,25)/t13-/m1/s1 |
| InChIKey | SBMPVHAXGUCZLB-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|