C16H20N2O5S — CID 8987349
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate (PubChem CID 8987349) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8987349 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cccc(S(=O)(=O)NCC=C)c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-4-9-17-15(19)12(3)23-16(20)13-7-6-8-14(11-13)24(21,22)18-10-5-2/h4-8,11-12,18H,1-2,9-10H2,3H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | SXIXGFADAUNYPX-LBPRGKRZSA-N |
| XLogP | 1.00 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|