C16H19N3O6S — CID 8987332
[(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate (PubChem CID 8987332) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8987332 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(2S)-1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 3-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)O[C@@H](C)C(=O)N2CCNC2=O)c1 |
| InChI | InChI=1S/C16H19N3O6S/c1-3-7-18-26(23,24)13-6-4-5-12(10-13)15(21)25-11(2)14(20)19-9-8-17-16(19)22/h3-6,10-11,18H,1,7-9H2,2H3,(H,17,22)/t11-/m0/s1 |
| InChIKey | NYTFBZTZXMOZRC-NSHDSACASA-N |
| XLogP | 0.25 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|