C19H20N2O5S — CID 7828390
[(2S)-1-anilino-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate (PubChem CID 7828390) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7828390 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl] 4-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O5S/c1-3-13-20-27(24,25)17-11-9-15(10-12-17)19(23)26-14(2)18(22)21-16-7-5-4-6-8-16/h3-12,14,20H,1,13H2,2H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | CQFLWBGKVWLUFK-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|