C27H35N3O6S — CID 4841740
[1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-[butyl(phenyl)sulfamoyl]benzoate (PubChem CID 4841740) has the molecular formula C27H35N3O6S and a molecular weight of 529.66 g/mol. Its IUPAC name is [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-[butyl(phenyl)sulfamoyl]benzoate.
| Compound Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-[butyl(phenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4841740 |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-[butyl(phenyl)sulfamoyl]benzoate |
| SMILES | CCCCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)OC(C)C(=O)NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C27H35N3O6S/c1-3-4-18-30(23-15-9-6-10-16-23)37(34,35)24-17-11-12-21(19-24)26(32)36-20(2)25(31)29-27(33)28-22-13-7-5-8-14-22/h6,9-12,15-17,19-20,22H,3-5,7-8,13-14,18H2,1-2H3,(H2,28,29,31,33) |
| InChIKey | MRJSWMSMRWWAEC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |