C18H21F3N2O4 — CID 7506538
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate (PubChem CID 7506538) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7506538 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(trifluoromethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(C(F)(F)F)c1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H21F3N2O4/c1-11(15(24)23-17(26)22-14-8-3-2-4-9-14)27-16(25)12-6-5-7-13(10-12)18(19,20)21/h5-7,10-11,14H,2-4,8-9H2,1H3,(H2,22,23,24,26)/t11-/m0/s1 |
| InChIKey | LZEMIAITKFVEPV-NSHDSACASA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |