C18H21F3N2O5 — CID 18274282
[1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenoxy]acetate (PubChem CID 18274282) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenoxy]acetate.
| Compound Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 18274282 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenoxy]acetate |
| SMILES | CC(OC(=O)COc1cccc(C(F)(F)F)c1)C(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H21F3N2O5/c1-11(16(25)23-17(26)22-13-6-2-3-7-13)28-15(24)10-27-14-8-4-5-12(9-14)18(19,20)21/h4-5,8-9,11,13H,2-3,6-7,10H2,1H3,(H2,22,23,25,26) |
| InChIKey | MKIGQDZQJPCUSG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |