C16H16N3O4S2- — CID 4568733
2,1,3-benzothiadiazol-4-ylsulfonyl-(2,5-diethoxyphenyl)azanide (PubChem CID 4568733) has the molecular formula C16H16N3O4S2- and a molecular weight of 378.46 g/mol. Its IUPAC name is 2,1,3-benzothiadiazol-4-ylsulfonyl-(2,5-diethoxyphenyl)azanide.
| Compound Name | 2,1,3-benzothiadiazol-4-ylsulfonyl-(2,5-diethoxyphenyl)azanide |
|---|---|
| PubChem CID | 4568733 |
| Molecular Formula | C16H16N3O4S2- |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2,1,3-benzothiadiazol-4-ylsulfonyl-(2,5-diethoxyphenyl)azanide |
| SMILES | CCOc1ccc(OCC)c([N-]S(=O)(=O)c2cccc3nsnc23)c1 |
| InChI | InChI=1S/C16H16N3O4S2/c1-3-22-11-8-9-14(23-4-2)13(10-11)19-25(20,21)15-7-5-6-12-16(15)18-24-17-12/h5-10H,3-4H2,1-2H3/q-1 |
| InChIKey | OMHLPWIDQQQTQS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|