C17H13N6O2S2- — CID 2021628
[3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)quinoxalin-2-yl]-prop-2-enylazanide (PubChem CID 2021628) has the molecular formula C17H13N6O2S2- and a molecular weight of 397.47 g/mol. Its IUPAC name is [3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)quinoxalin-2-yl]-prop-2-enylazanide.
| Compound Name | [3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)quinoxalin-2-yl]-prop-2-enylazanide |
|---|---|
| PubChem CID | 2021628 |
| Molecular Formula | C17H13N6O2S2- |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [3-(2,1,3-benzothiadiazol-4-ylsulfonylamino)quinoxalin-2-yl]-prop-2-enylazanide |
| SMILES | C=CC[N-]c1nc2ccccc2nc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C17H13N6O2S2/c1-2-10-18-16-17(20-12-7-4-3-6-11(12)19-16)23-27(24,25)14-9-5-8-13-15(14)22-26-21-13/h2-9H,1,10H2,(H-,18,19,20,23)/q-1 |
| InChIKey | WNMRLAGBCNDATB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|