C19H20N6O3S2 — CID 2010715
N-[3-(3-ethoxypropylamino)quinoxalin-2-yl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 2010715) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[3-(3-ethoxypropylamino)quinoxalin-2-yl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[3-(3-ethoxypropylamino)quinoxalin-2-yl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 2010715 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[3-(3-ethoxypropylamino)quinoxalin-2-yl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | CCOCCCNc1nc2ccccc2nc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C19H20N6O3S2/c1-2-28-12-6-11-20-18-19(22-14-8-4-3-7-13(14)21-18)25-30(26,27)16-10-5-9-15-17(16)24-29-23-15/h3-5,7-10H,2,6,11-12H2,1H3,(H,20,21)(H,22,25) |
| InChIKey | LIDSBGZYIBKVER-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|