C14H13BrF3N5O2S2 — CID 22208688
N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 22208688) has the molecular formula C14H13BrF3N5O2S2 and a molecular weight of 484.32 g/mol. Its IUPAC name is N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 22208688 |
| Molecular Formula | C14H13BrF3N5O2S2 |
| Molecular Weight | 484.32 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CCCNS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C14H13BrF3N5O2S2/c1-8-11(15)13(14(16,17)18)20-23(8)7-3-6-19-27(24,25)10-5-2-4-9-12(10)22-26-21-9/h2,4-5,19H,3,6-7H2,1H3 |
| InChIKey | XIIBLBZLMQQKJA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|