C14H14BrF3N4O4S — CID 22208675
N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-nitrobenzenesulfonamide (PubChem CID 22208675) has the molecular formula C14H14BrF3N4O4S and a molecular weight of 471.26 g/mol. Its IUPAC name is N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 22208675 |
| Molecular Formula | C14H14BrF3N4O4S |
| Molecular Weight | 471.26 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | N-[3-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CCCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14BrF3N4O4S/c1-9-12(15)13(14(16,17)18)20-21(9)8-4-7-19-27(25,26)11-6-3-2-5-10(11)22(23)24/h2-3,5-6,19H,4,7-8H2,1H3 |
| InChIKey | OFNQUUFBHIXDSX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|